What is the name for SbPO4?

What is the name for SbPO4?

Antimony(III) Phosphate. Alias: Antimonous Phosphate. Formula: SbPO4.

What is the method of antimony phosphate?

SbPO4
Chemical Identifiers

Linear Formula SbPO4
Beilstein/Reaxys No. N/A
Pubchem CID 21867851
IUPAC Name antimony(3+) phosphate
SMILES [SbH3+3].[O-]P([O-])([O-])=O

What element is Sb3?

Antimony(3+) is a monoatomic trication and an elemental antimony….4.3Related Element.

Element Name Antimony
Element Symbol Sb
Atomic Number 51

What is the chemical name of p3?

phosphide
Phosphide(3-)

PubChem CID 5182128
Structure Find Similar Structures
Molecular Formula P-3
Synonyms phosphide(3-) Phosphide phosphanetriide 22569-71-7 CHEBI:33468 More…
Molecular Weight 30.97376200

What is the formula for chromium III phosphate trihydrate?

Chromium(III) Phosphate Trihydrate CrPO4. 3H2O Molecular Weight — EndMemo.

What is 4H2O in chemistry?

4H2O approach there are 4 molecules of water. Also, the coefficient Four signifies that there are 4 molecules of H2O. Therefore, there are 8 hydrogen atoms in 4H2O.

What is the name of SbThree PO4 5?

Antimony(V) Phosphate Sb3(PO4)5 Molecular Weight — EndMemo.

What is the system for antimony V carbonate?

Antimony(V) Hydrogen Carbonate Sb(HCO3)5 Molecular Weight — EndMemo.

How many protons are in ion sb3?

Name Antimony
Atomic Number 51
Atomic Mass 121.76 atomic mass gadgets
Number of Protons 51
Number of Neutrons 71

What is the formulation of calcium phosphide?

Ca3P2
Calcium phosphide/Formula